C15H22N2O4S — CID 124782572
(8R)-2-methylsulfonyl-8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane (PubChem CID 124782572) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (8R)-2-methylsulfonyl-8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (8R)-2-methylsulfonyl-8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124782572 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (8R)-2-methylsulfonyl-8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane |
| SMILES | CS(=O)(=O)N1CC2(C1)OCC[C@H]2CCOCc1ccccn1 |
| InChI | InChI=1S/C15H22N2O4S/c1-22(18,19)17-11-15(12-17)13(6-9-21-15)5-8-20-10-14-4-2-3-7-16-14/h2-4,7,13H,5-6,8-12H2,1H3/t13-/m1/s1 |
| InChIKey | IDLBHXPURDVSFA-CYBMUJFWSA-N |
| XLogP | 1.04 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|