C26H33F3N2O6S — CID 155861400
8-(3,5-dimethylphenyl)sulfonyl-4-[2-(pyridin-2-ylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid (PubChem CID 155861400) has the molecular formula C26H33F3N2O6S and a molecular weight of 558.62 g/mol. Its IUPAC name is 8-(3,5-dimethylphenyl)sulfonyl-4-[2-(pyridin-2-ylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(3,5-dimethylphenyl)sulfonyl-4-[2-(pyridin-2-ylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861400 |
| Molecular Formula | C26H33F3N2O6S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 8-(3,5-dimethylphenyl)sulfonyl-4-[2-(pyridin-2-ylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decane;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)cc(S(=O)(=O)N2CCC3(CC2)OCCC3CCOCc2ccccn2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H32N2O4S.C2HF3O2/c1-19-15-20(2)17-23(16-19)31(27,28)26-11-8-24(9-12-26)21(7-14-30-24)6-13-29-18-22-5-3-4-10-25-22;3-2(4,5)1(6)7/h3-5,10,15-17,21H,6-9,11-14,18H2,1-2H3;(H,6,7) |
| InChIKey | DKPISYWKINIQAO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|