C25H29F6N3O8S — CID 155863845
4-[2-(pyridin-2-ylmethoxy)ethyl]-8-pyridin-3-ylsulfonyl-1-oxa-8-azaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155863845) has the molecular formula C25H29F6N3O8S and a molecular weight of 645.58 g/mol. Its IUPAC name is 4-[2-(pyridin-2-ylmethoxy)ethyl]-8-pyridin-3-ylsulfonyl-1-oxa-8-azaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[2-(pyridin-2-ylmethoxy)ethyl]-8-pyridin-3-ylsulfonyl-1-oxa-8-azaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155863845 |
| Molecular Formula | C25H29F6N3O8S |
| Molecular Weight | 645.58 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 4-[2-(pyridin-2-ylmethoxy)ethyl]-8-pyridin-3-ylsulfonyl-1-oxa-8-azaspiro[4.5]decane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=S(=O)(c1cccnc1)N1CCC2(CC1)OCCC2CCOCc1ccccn1 |
| InChI | InChI=1S/C21H27N3O4S.2C2HF3O2/c25-29(26,20-5-3-10-22-16-20)24-12-8-21(9-13-24)18(7-15-28-21)6-14-27-17-19-4-1-2-11-23-19;2*3-2(4,5)1(6)7/h1-5,10-11,16,18H,6-9,12-15,17H2;2*(H,6,7) |
| InChIKey | GTZROMAKDHPDSE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|