C25H34N2O3 — CID 131692091
1-adamantyl-[8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 131692091) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-adamantyl-[8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]methanone.
| Compound Name | 1-adamantyl-[8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 131692091 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1-adamantyl-[8-[2-(pyridin-2-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | O=C(N1CC2(C1)OCCC2CCOCc1ccccn1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H34N2O3/c28-23(24-12-18-9-19(13-24)11-20(10-18)14-24)27-16-25(17-27)21(5-8-30-25)4-7-29-15-22-3-1-2-6-26-22/h1-3,6,18-21H,4-5,7-17H2 |
| InChIKey | WAEQNULNFPQSBY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|