C33H26N2O5S — CID 124798362
(2'R,3R,3'S,10'bS)-3'-(2,5-dimethoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 124798362) has the molecular formula C33H26N2O5S and a molecular weight of 562.65 g/mol. Its IUPAC name is (2'R,3R,3'S,10'bS)-3'-(2,5-dimethoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3R,3'S,10'bS)-3'-(2,5-dimethoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 124798362 |
| Molecular Formula | C33H26N2O5S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (2'R,3R,3'S,10'bS)-3'-(2,5-dimethoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | COc1ccc(OC)c(C(=O)[C@@H]2[C@H](C(=O)c3cccs3)[C@]3(C(=O)Nc4ccccc43)[C@@H]3c4ccccc4C=CN23)c1 |
| InChI | InChI=1S/C33H26N2O5S/c1-39-20-13-14-25(40-2)22(18-20)29(36)28-27(30(37)26-12-7-17-41-26)33(23-10-5-6-11-24(23)34-32(33)38)31-21-9-4-3-8-19(21)15-16-35(28)31/h3-18,27-28,31H,1-2H3,(H,34,38)/t27-,28+,31+,33+/m1/s1 |
| InChIKey | KBOWMHAROVCLNI-UPOHCCNUSA-N |
| XLogP | 5.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |