C32H23BrN2O4S — CID 98457057
(2'R,3R,3'S,10'bR)-3'-(3-bromo-4-methoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 98457057) has the molecular formula C32H23BrN2O4S and a molecular weight of 611.52 g/mol. Its IUPAC name is (2'R,3R,3'S,10'bR)-3'-(3-bromo-4-methoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3R,3'S,10'bR)-3'-(3-bromo-4-methoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 98457057 |
| Molecular Formula | C32H23BrN2O4S |
| Molecular Weight | 611.52 g/mol |
| Exact Mass | 610.06 |
| IUPAC Name | (2'R,3R,3'S,10'bR)-3'-(3-bromo-4-methoxybenzoyl)-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H](C(=O)c3cccs3)[C@]3(C(=O)Nc4ccccc43)[C@H]3c4ccccc4C=CN23)cc1Br |
| InChI | InChI=1S/C32H23BrN2O4S/c1-39-24-13-12-19(17-22(24)33)28(36)27-26(29(37)25-11-6-16-40-25)32(21-9-4-5-10-23(21)34-31(32)38)30-20-8-3-2-7-18(20)14-15-35(27)30/h2-17,26-27,30H,1H3,(H,34,38)/t26-,27+,30-,32+/m1/s1 |
| InChIKey | CXOORHNTCPCQNC-BVHQZVKASA-N |
| XLogP | 6.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |