C18H21N3OS — CID 124798745
(7R)-7-(pyridin-2-ylmethoxy)-2-(pyridin-2-ylmethyl)-5-thia-2-azaspiro[3.4]octane (PubChem CID 124798745) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is (7R)-7-(pyridin-2-ylmethoxy)-2-(pyridin-2-ylmethyl)-5-thia-2-azaspiro[3.4]octane.
| Compound Name | (7R)-7-(pyridin-2-ylmethoxy)-2-(pyridin-2-ylmethyl)-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124798745 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (7R)-7-(pyridin-2-ylmethoxy)-2-(pyridin-2-ylmethyl)-5-thia-2-azaspiro[3.4]octane |
| SMILES | c1ccc(CO[C@H]2CSC3(C2)CN(Cc2ccccn2)C3)nc1 |
| InChI | InChI=1S/C18H21N3OS/c1-3-7-19-15(5-1)10-21-13-18(14-21)9-17(12-23-18)22-11-16-6-2-4-8-20-16/h1-8,17H,9-14H2/t17-/m1/s1 |
| InChIKey | ZEJBKRHEFPAMNQ-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |