C17H18N2O3S — CID 131660585
furan-2-yl-[7-(pyridin-2-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 131660585) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is furan-2-yl-[7-(pyridin-2-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone.
| Compound Name | furan-2-yl-[7-(pyridin-2-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 131660585 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | furan-2-yl-[7-(pyridin-2-ylmethoxy)-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | O=C(c1ccco1)N1CC2(CC(OCc3ccccn3)CS2)C1 |
| InChI | InChI=1S/C17H18N2O3S/c20-16(15-5-3-7-21-15)19-11-17(12-19)8-14(10-23-17)22-9-13-4-1-2-6-18-13/h1-7,14H,8-12H2 |
| InChIKey | NBJSENBJLMRZBS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |