C21H26N2O3 — CID 124798783
1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-3-methoxypropan-1-one (PubChem CID 124798783) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-3-methoxypropan-1-one.
| Compound Name | 1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 124798783 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-3-methoxypropan-1-one |
| SMILES | COCCC(=O)N1CC[C@H](Oc2cccnc2)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H26N2O3/c1-25-13-10-21(24)23-12-9-20(26-19-8-5-11-22-15-19)18(16-23)14-17-6-3-2-4-7-17/h2-8,11,15,18,20H,9-10,12-14,16H2,1H3/t18-,20+/m1/s1 |
| InChIKey | ZKYYBCOHVCXQHP-QUCCMNQESA-N |
| XLogP | 2.96 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |