C20H24N2O3 — CID 124788610
1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-2-methoxyethanone (PubChem CID 124788610) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 124788610 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[(3R,4S)-3-benzyl-4-pyridin-3-yloxypiperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@H](Oc2cccnc2)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-15-20(23)22-11-9-19(25-18-8-5-10-21-13-18)17(14-22)12-16-6-3-2-4-7-16/h2-8,10,13,17,19H,9,11-12,14-15H2,1H3/t17-,19+/m1/s1 |
| InChIKey | DDPVAVHHQUGIMR-MJGOQNOKSA-N |
| XLogP | 2.57 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |