C21H28N4O3S — CID 124800312
(1R,5S,6S,7R)-6-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-3-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 124800312) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is (1R,5S,6S,7R)-6-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-3-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1R,5S,6S,7R)-6-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-3-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 124800312 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (1R,5S,6S,7R)-6-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazine-1-carbonyl]-3-propan-2-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | Cc1nc(CN2CCN(C(=O)[C@@H]3[C@H]4C=C[C@@]5(CN(C(C)C)C(=O)[C@@H]35)O4)CC2)cs1 |
| InChI | InChI=1S/C21H28N4O3S/c1-13(2)25-12-21-5-4-16(28-21)17(18(21)20(25)27)19(26)24-8-6-23(7-9-24)10-15-11-29-14(3)22-15/h4-5,11,13,16-18H,6-10,12H2,1-3H3/t16-,17-,18-,21+/m1/s1 |
| InChIKey | FOBZIMVBWCHLCW-IKVWTGGYSA-N |
| XLogP | 1.29 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|