C21H25N3O2 — CID 124801292
[(3aR,7aS)-3a-[2-(pyridin-2-ylamino)ethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-phenylmethanone (PubChem CID 124801292) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3aR,7aS)-3a-[2-(pyridin-2-ylamino)ethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-phenylmethanone.
| Compound Name | [(3aR,7aS)-3a-[2-(pyridin-2-ylamino)ethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 124801292 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | [(3aR,7aS)-3a-[2-(pyridin-2-ylamino)ethyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC[C@@H]2OCC[C@]2(CCNc2ccccn2)C1 |
| InChI | InChI=1S/C21H25N3O2/c25-20(17-6-2-1-3-7-17)24-14-9-18-21(16-24,11-15-26-18)10-13-23-19-8-4-5-12-22-19/h1-8,12,18H,9-11,13-16H2,(H,22,23)/t18-,21+/m0/s1 |
| InChIKey | RSPFICUIVGEOIP-GHTZIAJQSA-N |
| XLogP | 3.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |