C15H22N2O5S — CID 97476498
N-[2-[(3aS,7aR)-5-(furan-3-carbonyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]methanesulfonamide (PubChem CID 97476498) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[2-[(3aS,7aR)-5-(furan-3-carbonyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3aS,7aR)-5-(furan-3-carbonyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 97476498 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[2-[(3aS,7aR)-5-(furan-3-carbonyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC[C@@]12CCO[C@@H]1CCN(C(=O)c1ccoc1)C2 |
| InChI | InChI=1S/C15H22N2O5S/c1-23(19,20)16-6-4-15-5-9-22-13(15)2-7-17(11-15)14(18)12-3-8-21-10-12/h3,8,10,13,16H,2,4-7,9,11H2,1H3/t13-,15+/m1/s1 |
| InChIKey | FCOWYKPMPQHOFZ-HIFRSBDPSA-N |
| XLogP | 0.84 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |