C19H23F6NO8 — CID 155841898
[4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-3-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155841898) has the molecular formula C19H23F6NO8 and a molecular weight of 507.38 g/mol. Its IUPAC name is [4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-3-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-3-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155841898 |
| Molecular Formula | C19H23F6NO8 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [4a-(methoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridin-6-yl]-(furan-3-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCC12CCCOC1CCN(C(=O)c1ccoc1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21NO4.2C2HF3O2/c1-18-11-15-5-2-7-20-13(15)3-6-16(10-15)14(17)12-4-8-19-9-12;2*3-2(4,5)1(6)7/h4,8-9,13H,2-3,5-7,10-11H2,1H3;2*(H,6,7) |
| InChIKey | GOWIWCDVJJYYGP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |