C15H20N4O3 — CID 124801348
(3aS,5S,7aS)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 124801348) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3aS,5S,7aS)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aS,5S,7aS)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 124801348 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (3aS,5S,7aS)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1cc(CN2CC[C@@H]3O[C@H](c4nnc(C)o4)CC[C@@H]32)no1 |
| InChI | InChI=1S/C15H20N4O3/c1-9-7-11(18-22-9)8-19-6-5-13-12(19)3-4-14(21-13)15-17-16-10(2)20-15/h7,12-14H,3-6,8H2,1-2H3/t12-,13-,14-/m0/s1 |
| InChIKey | XQDKQRABMQRVDX-IHRRRGAJSA-N |
| XLogP | 2.17 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |