C15H19N3O2S — CID 98811101
(3aR,5R,7aR)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 98811101) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aR,5R,7aR)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 98811101 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (3aR,5R,7aR)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1nnc([C@H]2CC[C@@H]3[C@@H](CCN3Cc3cccs3)O2)o1 |
| InChI | InChI=1S/C15H19N3O2S/c1-10-16-17-15(19-10)14-5-4-12-13(20-14)6-7-18(12)9-11-3-2-8-21-11/h2-3,8,12-14H,4-7,9H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | CPIUKNXAKDBHHH-MGPQQGTHSA-N |
| XLogP | 2.93 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |