C21H25N3O2 — CID 124803898
[(3S,3aR,6aR)-3-(pyrrolidin-1-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-quinolin-6-ylmethanone (PubChem CID 124803898) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3S,3aR,6aR)-3-(pyrrolidin-1-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-quinolin-6-ylmethanone.
| Compound Name | [(3S,3aR,6aR)-3-(pyrrolidin-1-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 124803898 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | [(3S,3aR,6aR)-3-(pyrrolidin-1-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-quinolin-6-ylmethanone |
| SMILES | O=C(c1ccc2ncccc2c1)N1C[C@H]2[C@@H](CN3CCCC3)CO[C@H]2C1 |
| InChI | InChI=1S/C21H25N3O2/c25-21(16-5-6-19-15(10-16)4-3-7-22-19)24-12-18-17(14-26-20(18)13-24)11-23-8-1-2-9-23/h3-7,10,17-18,20H,1-2,8-9,11-14H2/t17-,18-,20-/m0/s1 |
| InChIKey | ZRYYXWKIMLYJAB-BJLQDIEVSA-N |
| XLogP | 2.42 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |