C16H25N3O2S — CID 124804082
2-[[(3aR,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide (PubChem CID 124804082) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3aR,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 124804082 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[[(3aR,6aR)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COC[C@]12CCC[C@H]1CN(Cc1nccs1)C2 |
| InChI | InChI=1S/C16H25N3O2S/c1-18(2)15(20)10-21-12-16-5-3-4-13(16)8-19(11-16)9-14-17-6-7-22-14/h6-7,13H,3-5,8-12H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | HHDFDTYKMYRVGH-XJKSGUPXSA-N |
| XLogP | 1.85 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |