C18H26F3N3O4S — CID 155843172
2-[[(3aS,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155843172) has the molecular formula C18H26F3N3O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(3aS,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843172 |
| Molecular Formula | C18H26F3N3O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[[(3aS,6aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COC[C@@]12CCC[C@@H]1CN(Cc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O2S.C2HF3O2/c1-18(2)15(20)10-21-12-16-5-3-4-13(16)8-19(11-16)9-14-17-6-7-22-14;3-2(4,5)1(6)7/h6-7,13H,3-5,8-12H2,1-2H3;(H,6,7)/t13-,16+;/m1./s1 |
| InChIKey | HNIYKHBQKIPVKI-CACIRBSMSA-N |
| XLogP | 2.48 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |