C17H24F3N3O5S — CID 155852870
2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155852870) has the molecular formula C17H24F3N3O5S and a molecular weight of 439.46 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852870 |
| Molecular Formula | C17H24F3N3O5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)COC[C@]12COC[C@H]1CN(Cc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O3S.C2HF3O2/c1-17(2)14(19)8-21-11-15-9-18(5-12(15)7-20-10-15)6-13-16-3-4-22-13;3-2(4,5)1(6)7/h3-4,12H,5-11H2,1-2H3;(H,6,7)/t12-,15+;/m1./s1 |
| InChIKey | JNEPACPFKUBBBC-YLCXCWDSSA-N |
| XLogP | 1.33 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |