C19H27F3N2O5S — CID 155853905
(3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155853905) has the molecular formula C19H27F3N2O5S and a molecular weight of 452.50 g/mol. Its IUPAC name is (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853905 |
| Molecular Formula | C19H27F3N2O5S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (3aS,6aR)-3a-(oxan-4-ylmethoxymethyl)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2C[C@@H]3COC[C@]3(COCC3CCOCC3)C2)n1 |
| InChI | InChI=1S/C17H26N2O3S.C2HF3O2/c1-4-20-5-2-14(1)9-21-12-17-11-19(7-15(17)10-22-13-17)8-16-18-3-6-23-16;3-2(4,5)1(6)7/h3,6,14-15H,1-2,4-5,7-13H2;(H,6,7)/t15-,17-;/m1./s1 |
| InChIKey | FONNMBUCGYEKOC-SSPJITILSA-N |
| XLogP | 2.67 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |