C19H26F3N3O5S — CID 155845551
2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155845551) has the molecular formula C19H26F3N3O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845551 |
| Molecular Formula | C19H26F3N3O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[[(3aR,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(COC[C@]12COC[C@H]1CN(Cc1nccs1)C2)N1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3S.C2HF3O2/c21-16(20-4-1-2-5-20)10-23-13-17-11-19(7-14(17)9-22-12-17)8-15-18-3-6-24-15;3-2(4,5)1(6)7/h3,6,14H,1-2,4-5,7-13H2;(H,6,7)/t14-,17+;/m1./s1 |
| InChIKey | YNKKEPUFCUUPKJ-CVLQQERVSA-N |
| XLogP | 1.86 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |