C14H20F3N3O5S2 — CID 155825673
N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155825673) has the molecular formula C14H20F3N3O5S2 and a molecular weight of 431.46 g/mol. Its IUPAC name is N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825673 |
| Molecular Formula | C14H20F3N3O5S2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NC[C@]12COC[C@H]1CN(Cc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H19N3O3S2.C2HF3O2/c1-20(16,17)14-7-12-8-15(4-10(12)6-18-9-12)5-11-13-2-3-19-11;3-2(4,5)1(6)7/h2-3,10,14H,4-9H2,1H3;(H,6,7)/t10-,12+;/m1./s1 |
| InChIKey | HEJHCHCLIKTRDB-IYJPBCIQSA-N |
| XLogP | 0.77 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |