C15H22F3N3O5S2 — CID 155825565
N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155825565) has the molecular formula C15H22F3N3O5S2 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825565 |
| Molecular Formula | C15H22F3N3O5S2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[[(3aS,6aR)-5-(1,3-thiazol-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)NC[C@]12COC[C@H]1CN(Cc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H21N3O3S2.C2HF3O2/c1-2-21(17,18)15-8-13-9-16(5-11(13)7-19-10-13)6-12-14-3-4-20-12;3-2(4,5)1(6)7/h3-4,11,15H,2,5-10H2,1H3;(H,6,7)/t11-,13+;/m1./s1 |
| InChIKey | JPBAUSOEDSYWHD-YLAFAASESA-N |
| XLogP | 1.16 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |