C16H18FN5O2S — CID 124806065
N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 124806065) has the molecular formula C16H18FN5O2S and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 124806065 |
| Molecular Formula | C16H18FN5O2S |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[[(3R,3aR,6aR)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC[C@@H]2CO[C@H]3CN(c4ncc(F)cn4)C[C@@H]23)cs1 |
| InChI | InChI=1S/C16H18FN5O2S/c1-9-21-13(8-25-9)15(23)18-2-10-7-24-14-6-22(5-12(10)14)16-19-3-11(17)4-20-16/h3-4,8,10,12,14H,2,5-7H2,1H3,(H,18,23)/t10-,12+,14+/m1/s1 |
| InChIKey | AQHGDJDARCWIGU-OSMZGAPFSA-N |
| XLogP | 1.26 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |