C14H14FN5O2S — CID 125239008
N-[(3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide (PubChem CID 125239008) has the molecular formula C14H14FN5O2S and a molecular weight of 335.36 g/mol. Its IUPAC name is N-[(3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 125239008 |
| Molecular Formula | C14H14FN5O2S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[(3S,3aS,6aR)-1-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CN(c2ncc(F)cn2)[C@H]2COC[C@@H]12)c1cscn1 |
| InChI | InChI=1S/C14H14FN5O2S/c15-8-1-16-14(17-2-8)20-3-10(9-4-22-5-12(9)20)19-13(21)11-6-23-7-18-11/h1-2,6-7,9-10,12H,3-5H2,(H,19,21)/t9-,10+,12-/m0/s1 |
| InChIKey | QRWHTSGMMBIGMZ-UMNHJUIQSA-N |
| XLogP | 0.71 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |