C24H23N3O5S — CID 124807841
2-methyl-N-(4-methylphenyl)-5-[5-[(1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]-1,2,4-oxadiazol-3-yl]benzenesulfonamide (PubChem CID 124807841) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-methyl-N-(4-methylphenyl)-5-[5-[(1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]-1,2,4-oxadiazol-3-yl]benzenesulfonamide.
| Compound Name | 2-methyl-N-(4-methylphenyl)-5-[5-[(1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]-1,2,4-oxadiazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 124807841 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-methyl-N-(4-methylphenyl)-5-[5-[(1R,3S,6R,7R,9R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-9-yl]-1,2,4-oxadiazol-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(-c3noc([C@@H]4[C@@H]5C[C@@H]6[C@H]4C(=O)O[C@H]6C5)n3)ccc2C)cc1 |
| InChI | InChI=1S/C24H23N3O5S/c1-12-3-7-16(8-4-12)27-33(29,30)19-11-14(6-5-13(19)2)22-25-23(32-26-22)20-15-9-17-18(10-15)31-24(28)21(17)20/h3-8,11,15,17-18,20-21,27H,9-10H2,1-2H3/t15-,17+,18+,20-,21-/m1/s1 |
| InChIKey | ZRZYLSBKJGTGHZ-LFERKSGWSA-N |
| XLogP | 3.82 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |