C17H16N2O3 — CID 98533897
(1R,3S,6R,7R,9R)-9-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 98533897) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (1R,3S,6R,7R,9R)-9-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | (1R,3S,6R,7R,9R)-9-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 98533897 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1R,3S,6R,7R,9R)-9-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | Cc1ccc(-c2noc([C@@H]3[C@@H]4C[C@@H]5[C@H]3C(=O)O[C@H]5C4)n2)cc1 |
| InChI | InChI=1S/C17H16N2O3/c1-8-2-4-9(5-3-8)15-18-16(22-19-15)13-10-6-11-12(7-10)21-17(20)14(11)13/h2-5,10-14H,6-7H2,1H3/t10-,11+,12+,13-,14-/m1/s1 |
| InChIKey | BRWRHUDIVGYBEO-MBJXGIAVSA-N |
| XLogP | 2.71 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |