C25H30N4O2 — CID 124808884
(3aR,6aS)-2-methyl-1'-(2-phenylacetyl)-5-(pyridin-3-ylmethyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one (PubChem CID 124808884) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (3aR,6aS)-2-methyl-1'-(2-phenylacetyl)-5-(pyridin-3-ylmethyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one.
| Compound Name | (3aR,6aS)-2-methyl-1'-(2-phenylacetyl)-5-(pyridin-3-ylmethyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 124808884 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (3aR,6aS)-2-methyl-1'-(2-phenylacetyl)-5-(pyridin-3-ylmethyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
| SMILES | CN1C(=O)[C@@H]2CN(Cc3cccnc3)C[C@@H]2C12CCN(C(=O)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C25H30N4O2/c1-27-24(31)21-17-28(16-20-8-5-11-26-15-20)18-22(21)25(27)9-12-29(13-10-25)23(30)14-19-6-3-2-4-7-19/h2-8,11,15,21-22H,9-10,12-14,16-18H2,1H3/t21-,22+/m1/s1 |
| InChIKey | JEEJPRMSVQWIFQ-YADHBBJMSA-N |
| XLogP | 2.21 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |