C26H32N4O3 — CID 124831404
(3aR,6aS)-5-ethyl-1'-(4-methoxybenzoyl)-2-(pyridin-3-ylmethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one (PubChem CID 124831404) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is (3aR,6aS)-5-ethyl-1'-(4-methoxybenzoyl)-2-(pyridin-3-ylmethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one.
| Compound Name | (3aR,6aS)-5-ethyl-1'-(4-methoxybenzoyl)-2-(pyridin-3-ylmethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one |
|---|---|
| PubChem CID | 124831404 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (3aR,6aS)-5-ethyl-1'-(4-methoxybenzoyl)-2-(pyridin-3-ylmethyl)spiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-6-one |
| SMILES | CCN1C(=O)[C@@H]2CN(Cc3cccnc3)C[C@@H]2C12CCN(C(=O)c1ccc(OC)cc1)CC2 |
| InChI | InChI=1S/C26H32N4O3/c1-3-30-25(32)22-17-28(16-19-5-4-12-27-15-19)18-23(22)26(30)10-13-29(14-11-26)24(31)20-6-8-21(33-2)9-7-20/h4-9,12,15,22-23H,3,10-11,13-14,16-18H2,1-2H3/t22-,23+/m1/s1 |
| InChIKey | RSAUQOBNBMCHDA-PKTZIBPZSA-N |
| XLogP | 2.68 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |