C18H21N3O4S — CID 124811015
(8S)-2-(4-methylphenyl)sulfonyl-8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 124811015) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is (8S)-2-(4-methylphenyl)sulfonyl-8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane.
| Compound Name | (8S)-2-(4-methylphenyl)sulfonyl-8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 124811015 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (8S)-2-(4-methylphenyl)sulfonyl-8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(C[C@@H](Oc4cnccn4)CCO3)C2)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-14-2-4-16(5-3-14)26(22,23)21-12-18(13-21)10-15(6-9-24-18)25-17-11-19-7-8-20-17/h2-5,7-8,11,15H,6,9-10,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | XJQLIAPUZCAGOU-HNNXBMFYSA-N |
| XLogP | 1.79 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |