C17H19N5O3 — CID 131649493
(5-methylpyrazin-2-yl)-(8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl)methanone (PubChem CID 131649493) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-(8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl)methanone.
| Compound Name | (5-methylpyrazin-2-yl)-(8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl)methanone |
|---|---|
| PubChem CID | 131649493 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (5-methylpyrazin-2-yl)-(8-pyrazin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CC3(CC(Oc4cnccn4)CCO3)C2)cn1 |
| InChI | InChI=1S/C17H19N5O3/c1-12-7-21-14(8-20-12)16(23)22-10-17(11-22)6-13(2-5-24-17)25-15-9-18-3-4-19-15/h3-4,7-9,13H,2,5-6,10-11H2,1H3 |
| InChIKey | BTHNHYGZWBKXSS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |