C15H23FN4O2 — CID 124811184
2-[[(3R,3aR,7aS)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine (PubChem CID 124811184) has the molecular formula C15H23FN4O2 and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-[[(3R,3aR,7aS)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[(3R,3aR,7aS)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 124811184 |
| Molecular Formula | C15H23FN4O2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[[(3R,3aR,7aS)-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCO[C@@H]1CN(c2ncc(F)cn2)[C@H]2CCCO[C@@H]12 |
| InChI | InChI=1S/C15H23FN4O2/c1-19(2)5-7-21-13-10-20(12-4-3-6-22-14(12)13)15-17-8-11(16)9-18-15/h8-9,12-14H,3-7,10H2,1-2H3/t12-,13+,14+/m0/s1 |
| InChIKey | XAKZHBWMTRSBSF-BFHYXJOUSA-N |
| XLogP | 0.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |