C14H21FN4O — CID 97423170
(4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 97423170) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is (4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 97423170 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | CCN1C[C@H]2[C@@H](C1)N(c1ncc(F)cn1)CC[C@H]2OC |
| InChI | InChI=1S/C14H21FN4O/c1-3-18-8-11-12(9-18)19(5-4-13(11)20-2)14-16-6-10(15)7-17-14/h6-7,11-13H,3-5,8-9H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | LLIVGSHZUIVNRY-YNEHKIRRSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |