C22H26N4O — CID 124813712
(2S)-2-(2-methylbenzimidazol-1-yl)-1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propan-1-one (PubChem CID 124813712) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is (2S)-2-(2-methylbenzimidazol-1-yl)-1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-(2-methylbenzimidazol-1-yl)-1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 124813712 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2S)-2-(2-methylbenzimidazol-1-yl)-1-[(2R)-4-methyl-2-phenylpiperazin-1-yl]propan-1-one |
| SMILES | Cc1nc2ccccc2n1[C@@H](C)C(=O)N1CCN(C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26N4O/c1-16(26-17(2)23-19-11-7-8-12-20(19)26)22(27)25-14-13-24(3)15-21(25)18-9-5-4-6-10-18/h4-12,16,21H,13-15H2,1-3H3/t16-,21-/m0/s1 |
| InChIKey | AQLZRZVJOJXQQV-KKSFZXQISA-N |
| XLogP | 3.42 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |