C26H26ClF3N4O4 — CID 124814915
(1R,2S,5S,6S,7R,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(4-methoxyphenyl)-4-methyl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione (PubChem CID 124814915) has the molecular formula C26H26ClF3N4O4 and a molecular weight of 550.97 g/mol. Its IUPAC name is (1R,2S,5S,6S,7R,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(4-methoxyphenyl)-4-methyl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione.
| Compound Name | (1R,2S,5S,6S,7R,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(4-methoxyphenyl)-4-methyl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione |
|---|---|
| PubChem CID | 124814915 |
| Molecular Formula | C26H26ClF3N4O4 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | (1R,2S,5S,6S,7R,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5-(4-methoxyphenyl)-4-methyl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridecane-9,11-dione |
| SMILES | COc1ccc([C@@H]2[C@@H]3[C@H]4C[C@@H]([C@@H]3ON2C)[C@H]2C(=O)N(CCNc3ncc(C(F)(F)F)cc3Cl)C(=O)[C@@H]42)cc1 |
| InChI | InChI=1S/C26H26ClF3N4O4/c1-33-21(12-3-5-14(37-2)6-4-12)20-15-10-16(22(20)38-33)19-18(15)24(35)34(25(19)36)8-7-31-23-17(27)9-13(11-32-23)26(28,29)30/h3-6,9,11,15-16,18-22H,7-8,10H2,1-2H3,(H,31,32)/t15-,16+,18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | ZFOWGWQJAHTNCY-LULIQECKSA-N |
| XLogP | 4.03 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|