C34H25N3O6 — CID 124816675
(2'R,3S,3'S,10'bS)-3'-(2-methoxybenzoyl)-2'-(3-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 124816675) has the molecular formula C34H25N3O6 and a molecular weight of 571.59 g/mol. Its IUPAC name is (2'R,3S,3'S,10'bS)-3'-(2-methoxybenzoyl)-2'-(3-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3S,3'S,10'bS)-3'-(2-methoxybenzoyl)-2'-(3-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 124816675 |
| Molecular Formula | C34H25N3O6 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | (2'R,3S,3'S,10'bS)-3'-(2-methoxybenzoyl)-2'-(3-nitrobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | COc1ccccc1C(=O)[C@@H]1[C@H](C(=O)c2cccc([N+](=O)[O-])c2)[C@@]2(C(=O)Nc3ccccc32)[C@@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C34H25N3O6/c1-43-27-16-7-4-13-24(27)31(39)29-28(30(38)21-10-8-11-22(19-21)37(41)42)34(25-14-5-6-15-26(25)35-33(34)40)32-23-12-3-2-9-20(23)17-18-36(29)32/h2-19,28-29,32H,1H3,(H,35,40)/t28-,29+,32+,34-/m1/s1 |
| InChIKey | CHZRWCNJNSGYPL-IDFSYQMWSA-N |
| XLogP | 5.59 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|