C36H27N3O6 — CID 44665953
3'-(3-nitrobenzoyl)-2'-(2-prop-2-enoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 44665953) has the molecular formula C36H27N3O6 and a molecular weight of 597.63 g/mol. Its IUPAC name is 3'-(3-nitrobenzoyl)-2'-(2-prop-2-enoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | 3'-(3-nitrobenzoyl)-2'-(2-prop-2-enoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 44665953 |
| Molecular Formula | C36H27N3O6 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 3'-(3-nitrobenzoyl)-2'-(2-prop-2-enoxybenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | C=CCOc1ccccc1C(=O)C1C(C(=O)c2cccc([N+](=O)[O-])c2)N2C=Cc3ccccc3C2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C36H27N3O6/c1-2-20-45-29-17-8-5-14-26(29)33(41)30-31(32(40)23-11-9-12-24(21-23)39(43)44)38-19-18-22-10-3-4-13-25(22)34(38)36(30)27-15-6-7-16-28(27)37-35(36)42/h2-19,21,30-31,34H,1,20H2,(H,37,42) |
| InChIKey | QUHHVEIWASLWJA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|