C18H16INO2 — CID 1248180
5-ethyl-N-(3-iodophenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 1248180) has the molecular formula C18H16INO2 and a molecular weight of 405.24 g/mol. Its IUPAC name is 5-ethyl-N-(3-iodophenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethyl-N-(3-iodophenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 1248180 |
| Molecular Formula | C18H16INO2 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 5-ethyl-N-(3-iodophenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCc1ccc2oc(C(=O)Nc3cccc(I)c3)c(C)c2c1 |
| InChI | InChI=1S/C18H16INO2/c1-3-12-7-8-16-15(9-12)11(2)17(22-16)18(21)20-14-6-4-5-13(19)10-14/h4-10H,3H2,1-2H3,(H,20,21) |
| InChIKey | JJEHHXYDKZBXQT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|