C20H32N4O3 — CID 124819679
N,N-dimethyl-6-[(8S)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]pyrimidin-4-amine (PubChem CID 124819679) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is N,N-dimethyl-6-[(8S)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]pyrimidin-4-amine.
| Compound Name | N,N-dimethyl-6-[(8S)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 124819679 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N,N-dimethyl-6-[(8S)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]pyrimidin-4-amine |
| SMILES | CN(C)c1cc(N2CC3(C2)OCC[C@@H]3CCOCC2CCOCC2)ncn1 |
| InChI | InChI=1S/C20H32N4O3/c1-23(2)18-11-19(22-15-21-18)24-13-20(14-24)17(6-10-27-20)5-9-26-12-16-3-7-25-8-4-16/h11,15-17H,3-10,12-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | UZXHTCGEXZXGHM-KRWDZBQOSA-N |
| XLogP | 1.97 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|