C22H33NO4 — CID 124796778
(8S)-2-[(3-methoxyphenyl)methyl]-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane (PubChem CID 124796778) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (8S)-2-[(3-methoxyphenyl)methyl]-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (8S)-2-[(3-methoxyphenyl)methyl]-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124796778 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (8S)-2-[(3-methoxyphenyl)methyl]-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane |
| SMILES | COc1cccc(CN2CC3(C2)OCC[C@@H]3CCOCC2CCOCC2)c1 |
| InChI | InChI=1S/C22H33NO4/c1-24-21-4-2-3-19(13-21)14-23-16-22(17-23)20(8-12-27-22)7-11-26-15-18-5-9-25-10-6-18/h2-4,13,18,20H,5-12,14-17H2,1H3/t20-/m0/s1 |
| InChIKey | MYCPVIJKCVWGIQ-FQEVSTJZSA-N |
| XLogP | 3.12 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|