C19H23N3O3 — CID 124820270
1-[(2S,3aR,6aR)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(2-methylphenyl)ethanone (PubChem CID 124820270) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(2S,3aR,6aR)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(2-methylphenyl)ethanone.
| Compound Name | 1-[(2S,3aR,6aR)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 124820270 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(2S,3aR,6aR)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-2-(2-methylphenyl)ethanone |
| SMILES | Cc1nnc(C[C@@H]2C[C@@H]3CN(C(=O)Cc4ccccc4C)C[C@@H]3O2)o1 |
| InChI | InChI=1S/C19H23N3O3/c1-12-5-3-4-6-14(12)8-19(23)22-10-15-7-16(25-17(15)11-22)9-18-21-20-13(2)24-18/h3-6,15-17H,7-11H2,1-2H3/t15-,16+,17+/m1/s1 |
| InChIKey | JBMJRYKEVWRLPO-IKGGRYGDSA-N |
| XLogP | 2.09 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |