C15H19N3O3 — CID 97486904
(2R,3aS,6aS)-5-(furan-2-ylmethyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 97486904) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R,3aS,6aS)-5-(furan-2-ylmethyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (2R,3aS,6aS)-5-(furan-2-ylmethyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 97486904 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (2R,3aS,6aS)-5-(furan-2-ylmethyl)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1nnc(C[C@H]2C[C@H]3CN(Cc4ccco4)C[C@H]3O2)o1 |
| InChI | InChI=1S/C15H19N3O3/c1-10-16-17-15(20-10)6-13-5-11-7-18(9-14(11)21-13)8-12-3-2-4-19-12/h2-4,11,13-14H,5-9H2,1H3/t11-,13+,14+/m0/s1 |
| InChIKey | NLAHVSOBSNFQFN-IACUBPJLSA-N |
| XLogP | 1.80 |
| TPSA | 64.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |