C19H27ClN2O3S — CID 124821681
(4R,4aR,7aR)-6-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide (PubChem CID 124821681) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is (4R,4aR,7aR)-6-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide.
| Compound Name | (4R,4aR,7aR)-6-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 124821681 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (4R,4aR,7aR)-6-[(4-chlorophenyl)methyl]-N-(2-methylpropyl)-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrole-4-carboxamide |
| SMILES | CC(C)CNC(=O)[C@@H]1CCS(=O)(=O)[C@H]2CN(Cc3ccc(Cl)cc3)C[C@@H]12 |
| InChI | InChI=1S/C19H27ClN2O3S/c1-13(2)9-21-19(23)16-7-8-26(24,25)18-12-22(11-17(16)18)10-14-3-5-15(20)6-4-14/h3-6,13,16-18H,7-12H2,1-2H3,(H,21,23)/t16-,17+,18+/m1/s1 |
| InChIKey | LSLJTSFFVOWRIB-SQNIBIBYSA-N |
| XLogP | 2.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |