C19H26N2O4S — CID 125236059
[(4R,4aR,7aR)-6-benzyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone (PubChem CID 125236059) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is [(4R,4aR,7aR)-6-benzyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [(4R,4aR,7aR)-6-benzyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 125236059 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(4R,4aR,7aR)-6-benzyl-1,1-dioxo-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1CCS(=O)(=O)[C@H]2CN(Cc3ccccc3)C[C@@H]12)N1CCOCC1 |
| InChI | InChI=1S/C19H26N2O4S/c22-19(21-7-9-25-10-8-21)16-6-11-26(23,24)18-14-20(13-17(16)18)12-15-4-2-1-3-5-15/h1-5,16-18H,6-14H2/t16-,17+,18+/m1/s1 |
| InChIKey | ZDGFSFCWZUTNSV-SQNIBIBYSA-N |
| XLogP | 0.78 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |