C22H29F3N2O5S — CID 127022738
[(4S,4aS,7aS)-1,1-dioxo-6-(2-phenylethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 127022738) has the molecular formula C22H29F3N2O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is [(4S,4aS,7aS)-1,1-dioxo-6-(2-phenylethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4S,4aS,7aS)-1,1-dioxo-6-(2-phenylethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022738 |
| Molecular Formula | C22H29F3N2O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [(4S,4aS,7aS)-1,1-dioxo-6-(2-phenylethyl)-3,4,4a,5,7,7a-hexahydro-2H-thiopyrano[2,3-c]pyrrol-4-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@H]1CCS(=O)(=O)[C@@H]2CN(CCc3ccccc3)C[C@H]12)N1CCCC1 |
| InChI | InChI=1S/C20H28N2O3S.C2HF3O2/c23-20(22-10-4-5-11-22)17-9-13-26(24,25)19-15-21(14-18(17)19)12-8-16-6-2-1-3-7-16;3-2(4,5)1(6)7/h1-3,6-7,17-19H,4-5,8-15H2;(H,6,7)/t17-,18+,19+;/m0./s1 |
| InChIKey | XKEMLCINUGRZSD-JQPLGUQCSA-N |
| XLogP | 2.22 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |