C14H15F3NO2- — CID 150040902
(3S,4S)-1-(2-phenylethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylate (PubChem CID 150040902) has the molecular formula C14H15F3NO2- and a molecular weight of 286.27 g/mol. Its IUPAC name is (3S,4S)-1-(2-phenylethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylate.
| Compound Name | (3S,4S)-1-(2-phenylethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 150040902 |
| Molecular Formula | C14H15F3NO2- |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (3S,4S)-1-(2-phenylethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylate |
| SMILES | O=C([O-])[C@@H]1CN(CCc2ccccc2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c15-14(16,17)12-9-18(8-11(12)13(19)20)7-6-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,19,20)/p-1/t11-,12-/m1/s1 |
| InChIKey | DJGIVAIDHWKQHW-VXGBXAGGSA-M |
| XLogP | 1.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |