C21H30N2O2 — CID 136584809
(4-benzyl-1,4-diazepan-1-yl)-[(1R,2S)-2-(oxan-4-yl)cyclopropyl]methanone (PubChem CID 136584809) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (4-benzyl-1,4-diazepan-1-yl)-[(1R,2S)-2-(oxan-4-yl)cyclopropyl]methanone.
| Compound Name | (4-benzyl-1,4-diazepan-1-yl)-[(1R,2S)-2-(oxan-4-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 136584809 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (4-benzyl-1,4-diazepan-1-yl)-[(1R,2S)-2-(oxan-4-yl)cyclopropyl]methanone |
| SMILES | O=C([C@@H]1C[C@H]1C1CCOCC1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N2O2/c24-21(20-15-19(20)18-7-13-25-14-8-18)23-10-4-9-22(11-12-23)16-17-5-2-1-3-6-17/h1-3,5-6,18-20H,4,7-16H2/t19-,20+/m0/s1 |
| InChIKey | FDARAYGPTWGEEN-VQTJNVASSA-N |
| XLogP | 2.78 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |