C20H19Cl3O5 — CID 124822943
(2R,4S)-5-[5-chloro-2-[(2,4-dichlorophenyl)methyl]phenoxy]-2-methoxy-4-methyl-5-oxopentanoic acid (PubChem CID 124822943) has the molecular formula C20H19Cl3O5 and a molecular weight of 445.73 g/mol. Its IUPAC name is (2R,4S)-5-[5-chloro-2-[(2,4-dichlorophenyl)methyl]phenoxy]-2-methoxy-4-methyl-5-oxopentanoic acid.
| Compound Name | (2R,4S)-5-[5-chloro-2-[(2,4-dichlorophenyl)methyl]phenoxy]-2-methoxy-4-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 124822943 |
| Molecular Formula | C20H19Cl3O5 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (2R,4S)-5-[5-chloro-2-[(2,4-dichlorophenyl)methyl]phenoxy]-2-methoxy-4-methyl-5-oxopentanoic acid |
| SMILES | CO[C@H](C[C@H](C)C(=O)Oc1cc(Cl)ccc1Cc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C20H19Cl3O5/c1-11(7-18(27-2)19(24)25)20(26)28-17-10-15(22)6-4-13(17)8-12-3-5-14(21)9-16(12)23/h3-6,9-11,18H,7-8H2,1-2H3,(H,24,25)/t11-,18+/m0/s1 |
| InChIKey | ZKFBRKHIPWOLIH-BBATYDOGSA-N |
| XLogP | 5.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|