C28H19BrCl2N2O4 — CID 124822990
(1R,11S,12R,16S)-11-(3-bromo-4-methoxybenzoyl)-14-(2,4-dichlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 124822990) has the molecular formula C28H19BrCl2N2O4 and a molecular weight of 598.28 g/mol. Its IUPAC name is (1R,11S,12R,16S)-11-(3-bromo-4-methoxybenzoyl)-14-(2,4-dichlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1R,11S,12R,16S)-11-(3-bromo-4-methoxybenzoyl)-14-(2,4-dichlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 124822990 |
| Molecular Formula | C28H19BrCl2N2O4 |
| Molecular Weight | 598.28 g/mol |
| Exact Mass | 595.99 |
| IUPAC Name | (1R,11S,12R,16S)-11-(3-bromo-4-methoxybenzoyl)-14-(2,4-dichlorophenyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc(Cl)cc4Cl)C(=O)[C@@H]3[C@@H]3c4ccccc4C=CN23)cc1Br |
| InChI | InChI=1S/C28H19BrCl2N2O4/c1-37-21-9-6-15(12-18(21)29)26(34)25-23-22(24-17-5-3-2-4-14(17)10-11-32(24)25)27(35)33(28(23)36)20-8-7-16(30)13-19(20)31/h2-13,22-25H,1H3/t22-,23+,24-,25-/m0/s1 |
| InChIKey | GGVADCOUSJVDDO-NDBXHCKUSA-N |
| XLogP | 6.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.28 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|